![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | (Ebook - Martial Arts) 27 Katas Shotokan Karate.pdf | 06-Jan-2011 16:07 | 6.6M | |
![[ ]](/icons/unknown.gif) | (go to parent directory www.pauladaunt.com to use the search facility).rtf | 06-Jan-2011 16:11 | 486 | |
![[ ]](/icons/layout.gif) | 1-DunneJRealizingtheunreal.pdf | 23-Jan-2011 20:20 | 286K | |
![[ ]](/icons/layout.gif) | 3_teach.pdf | 06-Jan-2011 16:20 | 571K | |
![[ ]](/icons/layout.gif) | 4nobltru.pdf | 06-Jan-2011 16:11 | 254K | |
![[ ]](/icons/layout.gif) | 4sublime_states.pdf | 06-Jan-2011 15:22 | 590K | |
![[ ]](/icons/layout.gif) | 60songs.pdf | 06-Jan-2011 15:57 | 513K | |
![[TXT]](/icons/text.gif) | Abbie Hoffman - Steal This Book.txt | 06-Jan-2011 15:38 | 380K | |
![[TXT]](/icons/text.gif) | Aesop - Aesop's Fables.txt | 06-Jan-2011 16:11 | 62K | |
![[ ]](/icons/layout.gif) | Aikido The Art Of Fighting Without Fighting.pdf | 06-Jan-2011 15:27 | 2.7M | |
![[ ]](/icons/layout.gif) | Alan Watts - Philosophies Of Asia.pdf | 06-Jan-2011 15:47 | 344K | |
![[ ]](/icons/layout.gif) | Albert Einstein - Relativity.pdf | 06-Jan-2011 15:26 | 250K | |
![[TXT]](/icons/text.gif) | Albert Einstein - The World As I See It.txt | 06-Jan-2011 16:07 | 181K | |
![[TXT]](/icons/text.gif) | Aldous Huxley - The Doors of Perception.txt | 06-Jan-2011 15:27 | 105K | |
![[ ]](/icons/layout.gif) | Aldous_Huxley_-_Island.pdf | 06-Jan-2011 15:35 | 672K | |
![[ ]](/icons/layout.gif) | Aleister Crowley (Baphomet) - De Arte Magica.pdf | 06-Jan-2011 16:18 | 34K | |
![[ ]](/icons/layout.gif) | Aleister Crowley - Eight Lectures on Yoga.pdf | 06-Jan-2011 15:57 | 214K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Liber Samekh (800) - Theurgia Goetia Summ.txt | 06-Jan-2011 15:36 | 74K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Liber Samekh (800) - Theurgia Goetia Summa (Congressus Cum Daemone).txt | 06-Jan-2011 15:28 | 74K | |
![[TXT]](/icons/text.gif) | Andrew Lang - The Arabian Nights.txt | 06-Jan-2011 16:29 | 582K | |
![[ ]](/icons/unknown.gif) | AngelasAshes.doc | 06-Jan-2011 16:27 | 775K | |
![[TXT]](/icons/text.gif) | Anonymous - Beowulf.txt | 06-Jan-2011 16:11 | 143K | |
![[TXT]](/icons/text.gif) | Anthony Burgess - A Clockwork Orange.txt | 06-Jan-2011 16:03 | 83K | |
![[ ]](/icons/layout.gif) | Arp2600-FundamentalsOfMusicTechnology.pdf | 01-Apr-2011 13:36 | 1.6M | |
![[ ]](/icons/layout.gif) | ArtofWarbySunTzu.pdf | 26-Oct-2012 11:20 | 524K | |
![[DIR]](/icons/folder.gif) | Banned books and conspiracy theories/ | 04-Mar-2011 02:03 | - | |
![[ ]](/icons/layout.gif) | Book_of_Pleasure.pdf | 06-Jan-2011 16:20 | 250K | |
![[DIR]](/icons/folder.gif) | Books in Portuguese/ | 06-Jan-2011 13:47 | - | |
![[TXT]](/icons/text.gif) | Bram Stoker - Dracula.txt | 06-Jan-2011 13:48 | 825K | |
![[TXT]](/icons/text.gif) | Bram Stoker - The Lair of the White Worm.txt | 06-Jan-2011 13:48 | 308K | |
![[ ]](/icons/layout.gif) | Buddhism__Dharma_Mind_Worldly_Mind_-_David_Smith.pdf | 06-Jan-2011 13:49 | 947K | |
![[DIR]](/icons/folder.gif) | CARNEGIE, Dale - How to Stop Worrying and Start Living (txt)/ | 06-Jan-2011 13:52 | - | |
![[ ]](/icons/unknown.gif) | CARNEGIE, Dale - How to Win Friends and Influence People.rtf | 06-Jan-2011 13:52 | 515K | |
![[ ]](/icons/layout.gif) | CONTEMPLATION OF THE MIND - PRACTISING CITTÆNUPASSANÆ.pdf | 06-Jan-2011 14:04 | 1.2M | |
![[DIR]](/icons/folder.gif) | Camus/ | 06-Jan-2011 13:50 | - | |
![[ ]](/icons/layout.gif) | ChangingImagesOfMan-OCR.pdf | 06-Jan-2011 13:54 | 4.5M | |
![[ ]](/icons/layout.gif) | Che Guevara - Afro-Asian Conference.pdf | 06-Jan-2011 13:55 | 36K | |
![[ ]](/icons/layout.gif) | Che Guevara - At The UN.pdf | 06-Jan-2011 13:55 | 19K | |
![[ ]](/icons/layout.gif) | Che Guevara - Colonialism Is Doomed.pdf | 06-Jan-2011 13:55 | 57K | |
![[ ]](/icons/layout.gif) | Che Guevara - Exceptional Case.pdf | 06-Jan-2011 13:55 | 29K | |
![[ ]](/icons/layout.gif) | Che Guevara - Growth And Imperialism.pdf | 06-Jan-2011 13:55 | 114K | |
![[ ]](/icons/layout.gif) | Che Guevara - Guerilla Warfare.pdf | 06-Jan-2011 13:55 | 67K | |
![[ ]](/icons/layout.gif) | Che Guevara - Man And Socialism.pdf | 06-Jan-2011 13:55 | 64K | |
![[ ]](/icons/layout.gif) | Che Guevara - Notes For Study.pdf | 06-Jan-2011 13:55 | 23K | |
![[ ]](/icons/layout.gif) | Che Guevara - On Development.pdf | 06-Jan-2011 13:55 | 72K | |
![[ ]](/icons/layout.gif) | Che Guevara - Revolutionary Medicine.pdf | 06-Jan-2011 13:55 | 36K | |
![[ ]](/icons/layout.gif) | Che Guevara - The Cadres.pdf | 06-Jan-2011 13:55 | 24K | |
![[ ]](/icons/layout.gif) | Chi Nei Tsang Internal Organs Chi Massage.pdf | 06-Jan-2011 13:58 | 8.3M | |
![[DIR]](/icons/folder.gif) | Children's/ | 06-Jan-2011 14:00 | - | |
![[ ]](/icons/layout.gif) | Chinese Self healing Methods For Health.pdf | 06-Jan-2011 14:00 | 141K | |
![[DIR]](/icons/folder.gif) | Classic Science Fiction/ | 06-Jan-2011 14:03 | - | |
![[ ]](/icons/unknown.gif) | Curse of Lono Hunter S Thompson.doc | 06-Jan-2011 14:04 | 446K | |
![[DIR]](/icons/folder.gif) | Cyberpunk/ | 06-Jan-2011 14:05 | - | |
![[TXT]](/icons/text.gif) | D. H. Lawrence - Sons And Lovers.txt | 06-Jan-2011 14:06 | 867K | |
![[ ]](/icons/layout.gif) | Dave Pelzer - A Child Called 'It'-1.pdf | 06-Jan-2011 14:06 | 313K | |
![[ ]](/icons/layout.gif) | Dave Pelzer - A Child Called 'It'.pdf | 06-Jan-2011 14:06 | 313K | |
![[ ]](/icons/layout.gif) | David K. Cheng - Field and Wave Electromagnetics 2ed Solution Manual.pdf | 06-Jan-2011 14:07 | 3.3M | |
![[ ]](/icons/layout.gif) | Deschooling Society by Ivan Illich.pdf | 06-Jan-2011 14:07 | 443K | |
![[ ]](/icons/layout.gif) | Do It Yourself A Handbook for Changing our World.pdf | 28-Nov-2011 13:34 | 7.3M | |
![[DIR]](/icons/folder.gif) | EBOOK_TSOG_robert_anton_wilson 3/ | 06-Jan-2011 14:08 | - | |
![[ ]](/icons/layout.gif) | Ebook_-_Brainwave_-_EEG_and_Tr.pdf | 23-Jan-2011 20:19 | 53K | |
![[TXT]](/icons/text.gif) | FORSYTH, Frederick - Icon.txt | 06-Jan-2011 14:10 | 916K | |
![[TXT]](/icons/text.gif) | F Scott Fitzgerald - The Great Gatsby.txt | 06-Jan-2011 14:09 | 271K | |
![[TXT]](/icons/text.gif) | Fahrenheit 451.txt | 06-Jan-2011 14:10 | 245K | |
![[TXT]](/icons/text.gif) | FearAndLoathing.htm | 06-Jan-2011 14:10 | 303K | |
![[TXT]](/icons/text.gif) | Freud,_Sigmund_-_A_Young_Girl's_Diary.txt | 06-Jan-2011 14:11 | 467K | |
![[TXT]](/icons/text.gif) | Freud,_Sigmund_-_Interpretation_of_Dreams.txt | 06-Jan-2011 14:11 | 1.6M | |
![[ ]](/icons/layout.gif) | Fritjof Capra - The Tao of Physics.pdf | 06-Jan-2011 14:13 | 11M | |
![[ ]](/icons/layout.gif) | From_Political_Economy_to_Freakonomics.pdf | 06-Jan-2011 14:14 | 2.4M | |
![[TXT]](/icons/text.gif) | Fundamental Principles of the Metaphysic of Morals by Immanuel Kant.txt | 06-Jan-2011 14:14 | 187K | |
![[DIR]](/icons/folder.gif) | George Orwell/ | 06-Jan-2011 14:14 | - | |
![[ ]](/icons/layout.gif) | Giordano Bruno-Cause, Principle and Unity-And Essays on Magic.pdf | 06-Jan-2011 14:15 | 907K | |
![[ ]](/icons/layout.gif) | Global_Warming_Introduction.pdf | 06-Jan-2011 14:15 | 3.7M | |
![[TXT]](/icons/text.gif) | Golding, William - Lord of the Flies v1.0.txt | 06-Jan-2011 14:15 | 339K | |
![[ ]](/icons/unknown.gif) | Greene, Graham - The Power and the Glory v1.0.rtf | 06-Jan-2011 14:16 | 426K | |
![[ ]](/icons/layout.gif) | H.G. Wells - Complete Works.pdf | 28-Nov-2011 13:39 | 11M | |
![[ ]](/icons/unknown.gif) | HFilding.BridgetJonesDiary.doc | 06-Jan-2011 14:18 | 623K | |
![[ ]](/icons/layout.gif) | Handbook of Quantum Logic and Quantum Structures.pdf | 06-Jan-2011 14:17 | 4.3M | |
![[ ]](/icons/layout.gif) | Helen_Doron_Bericht_End_Deu.pdf | 10-Jan-2013 15:07 | 4.1M | |
![[TXT]](/icons/text.gif) | Heller, Joseph - Catch-22 v1.0.txt | 06-Jan-2011 14:18 | 1.0M | |
![[DIR]](/icons/folder.gif) | Horror/ | 06-Jan-2011 14:19 | - | |
![[ ]](/icons/layout.gif) | Hypnosis - Seven Success Secrets of Hypnotism.pdf | 06-Jan-2011 14:19 | 48K | |
![[ ]](/icons/layout.gif) | Illuminates_of_Thanateros.pdf | 06-Jan-2011 14:19 | 1.5M | |
![[DIR]](/icons/folder.gif) | Illuminatus/ | 06-Jan-2011 16:26 | - | |
![[DIR]](/icons/folder.gif) | Immanuel Kant - The Metaphysical Elements of Ethics/ | 06-Jan-2011 16:26 | - | |
![[TXT]](/icons/text.gif) | Immanuel Kant - Universal Natural History and Theory of Heaven.txt | 06-Jan-2011 16:25 | 312K | |
![[TXT]](/icons/text.gif) | Interview with Robert Anton Wilson.htm | 06-Jan-2011 15:22 | 47K | |
![[ ]](/icons/layout.gif) | Introduction_Africana_Philosophy.pdf | 06-Jan-2011 15:56 | 1.1M | |
![[TXT]](/icons/text.gif) | J.D.Salinger - The Catcher In The Rye.txt | 06-Jan-2011 15:33 | 373K | |
![[TXT]](/icons/text.gif) | J. D. Salinger - Uncollected.txt | 06-Jan-2011 15:36 | 677K | |
![[DIR]](/icons/folder.gif) | James Joyce - Ulysses (1922 Text)/ | 06-Jan-2011 16:28 | - | |
![[ ]](/icons/unknown.gif) | John Gray - Men are from Mars, Women are from Venus (v2-1.0).rtf | 06-Jan-2011 15:45 | 1.0M | |
![[ ]](/icons/unknown.gif) | John Gray - Men are from Mars, Women are from Venus (v2.0).rtf | 06-Jan-2011 15:23 | 1.0M | |
![[DIR]](/icons/folder.gif) | John Stuart Mill - Utilitarianism/ | 06-Jan-2011 15:36 | - | |
![[ ]](/icons/layout.gif) | Journalism_Introduction.pdf | 06-Jan-2011 16:25 | 3.6M | |
![[TXT]](/icons/text.gif) | Kerouac, Jack - On The Road.txt | 06-Jan-2011 15:35 | 597K | |
![[ ]](/icons/layout.gif) | Kim, Ashida - Secrets of the Ninja.pdf | 06-Jan-2011 16:07 | 1.7M | |
![[TXT]](/icons/text.gif) | LEE, Harper - To Kill A Mockingbird.txt | 06-Jan-2011 15:27 | 740K | |
![[DIR]](/icons/folder.gif) | Lewis Carrol/ | 06-Jan-2011 15:47 | - | |
![[ ]](/icons/layout.gif) | Liber (0242) CCXXLII - AHA!.pdf | 06-Jan-2011 15:57 | 46K | |
![[ ]](/icons/layout.gif) | Linux - Unix System Administration Handbook (Prentice Hall).pdf | 06-Jan-2011 15:57 | 302K | |
![[ ]](/icons/layout.gif) | Linux Web Solution - php - mySql - Apache.pdf | 06-Jan-2011 15:33 | 400K | |
![[TXT]](/icons/text.gif) | MARQUES, Gabriel Garcia - One Hundred Years of Solitude.txt | 06-Jan-2011 15:27 | 795K | |
![[ ]](/icons/layout.gif) | Madonna - Sex.pdf | 06-Jan-2011 16:24 | 6.4M | |
![[ ]](/icons/layout.gif) | Magic in ancient Egypt.pdf | 06-Jan-2011 16:19 | 5.4M | |
![[TXT]](/icons/text.gif) | Marquis De Sade - The 120 Days Of Sodom.txt | 06-Jan-2011 15:45 | 1.0M | |
![[ ]](/icons/layout.gif) | Martial-Arts_ Pressure Points - Military Hand to Hand Combat Guide.pdf | 06-Jan-2011 16:22 | 613K | |
![[ ]](/icons/layout.gif) | Martial Arts - Bruce Lee'S Jeet Kune Do.pdf | 06-Jan-2011 16:29 | 677K | |
![[ ]](/icons/layout.gif) | Martial Arts - Bruce Lee_S Jeet Kune Do.pdf | 06-Jan-2011 15:27 | 677K | |
![[ ]](/icons/layout.gif) | Martial Arts - Bruce Lee_s Speed Training.pdf | 06-Jan-2011 15:36 | 17K | |
![[ ]](/icons/layout.gif) | Martial Arts - Bruce Lee_s Training Secrets.pdf | 06-Jan-2011 15:29 | 12K | |
![[ ]](/icons/layout.gif) | Martial Arts - Qigong For Health And Vitality.pdf | 06-Jan-2011 15:26 | 13M | |
![[ ]](/icons/layout.gif) | Martial Arts_ - Bruce Lee - The Power Of The Dragon.pdf | 06-Jan-2011 15:22 | 1.1M | |
![[ ]](/icons/layout.gif) | Martial Arts_ - Self-Defense Nerve Centers and Pressure Points _1_.pdf | 06-Jan-2011 16:17 | 1.9M | |
![[ ]](/icons/compressed.gif) | Medicinal Herbs.zip | 06-Jan-2011 15:27 | 24K | |
![[TXT]](/icons/text.gif) | Meditations_of_Marcus_Aurelius.txt | 06-Jan-2011 16:11 | 403K | |
![[ ]](/icons/unknown.gif) | Metamorphosis - Kafka, Franz.rtf | 06-Jan-2011 15:36 | 159K | |
![[DIR]](/icons/folder.gif) | Miller, H; Burroughs, Kerouac/ | 06-Jan-2011 15:43 | - | |
![[ ]](/icons/layout.gif) | NLP Communication Model.pdf | 06-Jan-2011 16:22 | 147K | |
![[IMG]](/icons/image2.gif) | Nagaosa N. QFT in condensed matter physics (Springer, 1999)(T)(ISBN 3540655379)(214s).djvu | 06-Jan-2011 15:28 | 1.8M | |
![[ ]](/icons/unknown.gif) | Nick Hornby - How to Be Good.doc | 06-Jan-2011 16:11 | 511K | |
![[ ]](/icons/layout.gif) | Ninja_Combat_Method_-_Stephen_K._Hayes.pdf | 06-Jan-2011 15:29 | 1.6M | |
![[ ]](/icons/layout.gif) | Ninja_Vol_1.pdf | 06-Jan-2011 15:56 | 10M | |
![[IMG]](/icons/image2.gif) | Nonperturbative Quantum Field Theory and the Structure of Matter (Fundamental Theories of Physics).djvu | 06-Jan-2011 16:10 | 2.6M | |
![[DIR]](/icons/folder.gif) | Oreilly.Learning.Unix.For.Mac.OS.X.Panther.eBook-LiB.chm.1.rar/ | 06-Jan-2011 16:09 | - | |
![[TXT]](/icons/text.gif) | PASTERNAK, Boris - Doctor Zhivago.txt | 06-Jan-2011 16:17 | 1.1M | |
![[ ]](/icons/layout.gif) | Paper Folding (ebook).pdf | 06-Jan-2011 15:28 | 734K | |
![[ ]](/icons/layout.gif) | Pressure Points.pdf | 06-Jan-2011 15:59 | 1.9M | |
![[TXT]](/icons/text.gif) | Quentin Tarantino - Pulp Fiction script.txt | 06-Jan-2011 15:22 | 301K | |
![[TXT]](/icons/text.gif) | Ray Bradbury - Short Stories.txt | 06-Jan-2011 15:22 | 211K | |
![[TXT]](/icons/text.gif) | Rene Descartes - Meditations on First Philosophy.txt | 06-Jan-2011 15:37 | 170K | |
![[TXT]](/icons/text.gif) | Rene Descartes - Reason Discourse.txt | 06-Jan-2011 16:27 | 126K | |
![[TXT]](/icons/text.gif) | Rene Descartes - Truth in the Sciences.txt | 06-Jan-2011 15:57 | 126K | |
![[ ]](/icons/layout.gif) | Robert Anton Wilson - Prometheus Rising.pdf | 06-Jan-2011 15:47 | 4.0M | |
![[ ]](/icons/layout.gif) | Robert_Anton_Wilson_-_Quantum_Psychology.pdf | 06-Jan-2011 16:22 | 8.0M | |
![[ ]](/icons/layout.gif) | SHAKESPEAREgabEag.pdf | 06-Jan-2011 15:34 | 1.0M | |
![[TXT]](/icons/text.gif) | Saint Joan_A Chronicle Play In Six Scenes And An Epilogue.txt | 06-Jan-2011 16:08 | 317K | |
![[DIR]](/icons/folder.gif) | Schrodinger's Cat/ | 06-Jan-2011 15:35 | - | |
![[ ]](/icons/layout.gif) | Science_Fiction_Quotations.pdf | 06-Jan-2011 15:35 | 5.5M | |
![[ ]](/icons/layout.gif) | Secrets of the Ninja.pdf | 06-Jan-2011 16:05 | 9.0M | |
![[ ]](/icons/layout.gif) | Sibelius Tutorial.pdf | 06-Jan-2011 15:26 | 91K | |
![[DIR]](/icons/folder.gif) | Snow/ | 06-Jan-2011 15:53 | - | |
![[ ]](/icons/layout.gif) | Social Media Marketing.pdf | 23-Jan-2011 20:21 | 4.7M | |
![[DIR]](/icons/folder.gif) | Stressbusting/ | 06-Jan-2011 15:56 | - | |
![[ ]](/icons/layout.gif) | Symbolsprache_Talismane_Amulette.pdf | 06-Jan-2011 15:37 | 3.9M | |
![[ ]](/icons/layout.gif) | THE THEORY AND TECHNIQUE OF ELECTRONIC MUSIC by Miller Puckette.pdf | 23-Jan-2011 20:19 | 1.9M | |
![[ ]](/icons/layout.gif) | Tai Chi Yang Sword Form 32.pdf | 06-Jan-2011 15:38 | 198K | |
![[ ]](/icons/layout.gif) | The Art of Scientific Investigation .pdf | 01-Apr-2013 10:31 | 12M | |
![[ ]](/icons/layout.gif) | The Brainwashing Manual .pdf | 06-Jan-2011 16:26 | 134K | |
![[ ]](/icons/layout.gif) | The Creative Mind_ Myths and Mechanisms.pdf | 06-Jan-2011 15:57 | 2.0M | |
![[TXT]](/icons/text.gif) | The Critique of Practical Reason by Immanuel Kant.txt | 06-Jan-2011 16:05 | 377K | |
![[TXT]](/icons/text.gif) | The Critique of Pure Reason by Immanuel Kant.txt | 06-Jan-2011 16:25 | 1.2M | |
![[ ]](/icons/unknown.gif) | The Eighteenth Brumaire of Louis Bonaparte | 06-Jan-2011 15:26 | 254K | |
![[ ]](/icons/layout.gif) | The Filipino Martial Arts - Dan Inosanto.pdf | 06-Jan-2011 15:41 | 9.5M | |
![[ ]](/icons/layout.gif) | The Illuminati Papers by Robert Anton Wilson.pdf | 06-Jan-2011 15:36 | 33K | |
![[TXT]](/icons/text.gif) | The Metaphysical Elements of Ethics by Immanuel Kant.txt | 06-Jan-2011 15:34 | 91K | |
![[ ]](/icons/layout.gif) | The Shaggy Steed of Physics Mathematical Beauty in the Physical World.pdf | 06-Jan-2011 15:33 | 3.8M | |
![[TXT]](/icons/text.gif) | The Yoga Sutras of Patanjali by Charles Johnston.txt | 06-Jan-2011 15:57 | 184K | |
![[ ]](/icons/layout.gif) | The_Complete_Works_of_H.P._Lovecraft.pdf | 28-Nov-2011 13:39 | 7.8M | |
![[ ]](/icons/layout.gif) | The_Paradox_Of_Becoming-Thanissaro_Bhikkhu .pdf | 06-Jan-2011 15:38 | 719K | |
![[DIR]](/icons/folder.gif) | The trial - Kafka, Franz/ | 06-Jan-2011 15:47 | - | |
![[ ]](/icons/layout.gif) | Vampirella - (Ebook Comic Erotic).pdf | 06-Jan-2011 15:32 | 14M | |
![[DIR]](/icons/folder.gif) | Veggie recipies/ | 06-Jan-2011 15:58 | - | |
![[ ]](/icons/layout.gif) | abhistudy.pdf | 06-Jan-2011 16:26 | 690K | |
![[ ]](/icons/layout.gif) | advice.pdf | 06-Jan-2011 15:43 | 896K | |
![[DIR]](/icons/folder.gif) | afullerex Folder/ | 06-Jan-2011 13:35 | - | |
![[ ]](/icons/layout.gif) | allmetta.pdf | 06-Jan-2011 15:41 | 205K | |
![[ ]](/icons/layout.gif) | ananda1.pdf | 06-Jan-2011 15:36 | 1.0M | |
![[ ]](/icons/layout.gif) | anapanasati.pdf | 06-Jan-2011 15:45 | 1.2M | |
![[ ]](/icons/layout.gif) | applied_magic_dion_fortune.pdf | 06-Jan-2011 15:59 | 516K | |
![[ ]](/icons/layout.gif) | artofatt.pdf | 06-Jan-2011 15:26 | 94K | |
![[ ]](/icons/layout.gif) | artofscientificinvestigation60beve.pdf | 18-Jul-2012 10:14 | 12M | |
![[ ]](/icons/layout.gif) | bd_students.pdf | 06-Jan-2011 15:33 | 839K | |
![[ ]](/icons/layout.gif) | beingssutra.pdf | 06-Jan-2011 16:03 | 1.2M | |
![[ ]](/icons/layout.gif) | beyond-belief02.pdf | 06-Jan-2011 16:29 | 929K | |
![[ ]](/icons/layout.gif) | bhkkrule.pdf | 06-Jan-2011 16:22 | 1.0M | |
![[ ]](/icons/layout.gif) | bm7insight.pdf | 06-Jan-2011 15:28 | 435K | |
![[ ]](/icons/layout.gif) | bookchant.pdf | 06-Jan-2011 16:18 | 434K | |
![[TXT]](/icons/text.gif) | brave new world - by aldous huxley.txt | 06-Jan-2011 13:48 | 112K | |
![[ ]](/icons/layout.gif) | breathmind.pdf | 06-Jan-2011 13:48 | 1.2M | |
![[ ]](/icons/layout.gif) | bud-myanmar.pdf | 06-Jan-2011 13:48 | 623K | |
![[ ]](/icons/layout.gif) | bud-srilanka.pdf | 06-Jan-2011 13:49 | 700K | |
![[ ]](/icons/layout.gif) | bud-thailand.pdf | 06-Jan-2011 13:49 | 406K | |
![[ ]](/icons/layout.gif) | buddhist_funeral.pdf | 06-Jan-2011 13:49 | 1.1M | |
![[ ]](/icons/layout.gif) | buddhistway.pdf | 06-Jan-2011 13:50 | 734K | |
![[ ]](/icons/layout.gif) | budrelig.pdf | 06-Jan-2011 13:50 | 134K | |
![[TXT]](/icons/text.gif) | canterbury tales - by geoffrey chaucer.txt | 06-Jan-2011 13:52 | 182K | |
![[ ]](/icons/layout.gif) | catch22.pdf | 06-Jan-2011 13:53 | 1.3M | |
![[ ]](/icons/layout.gif) | ceremonies-srilanka6.pdf | 06-Jan-2011 13:53 | 1.2M | |
![[ ]](/icons/layout.gif) | chanmed1.pdf | 06-Jan-2011 13:55 | 609K | |
![[ ]](/icons/layout.gif) | crome_yellow_aldous_huxley.pdf | 28-Nov-2011 13:33 | 430K | |
![[ ]](/icons/layout.gif) | damapada.pdf | 06-Jan-2011 14:06 | 586K | |
![[ ]](/icons/layout.gif) | death_dying.pdf | 06-Jan-2011 14:07 | 199K | |
![[ ]](/icons/layout.gif) | deathless.pdf | 06-Jan-2011 14:07 | 861K | |
![[ ]](/icons/layout.gif) | de gourmont - the natural philosophy of love.pdf | 06-Jan-2011 14:07 | 216K | |
![[ ]](/icons/layout.gif) | dmind-wmind.pdf | 06-Jan-2011 14:07 | 947K | |
![[ ]](/icons/layout.gif) | eBook - Aleister Crowley - Book of Lies.pdf | 06-Jan-2011 14:07 | 309K | |
![[ ]](/icons/layout.gif) | ebook.-.PDF.The.Brainwashing.Manual..pdf | 23-Jan-2011 20:20 | 134K | |
![[ ]](/icons/layout.gif) | edicts-asoka6.pdf | 06-Jan-2011 14:08 | 667K | |
![[ ]](/icons/layout.gif) | ele_pali.pdf | 06-Jan-2011 14:08 | 816K | |
![[ ]](/icons/layout.gif) | essentials.pdf | 06-Jan-2011 14:09 | 3.3M | |
![[ ]](/icons/layout.gif) | essentialsof.pdf | 06-Jan-2011 14:09 | 794K | |
![[DIR]](/icons/folder.gif) | ezine/ | 06-Jan-2011 14:09 | - | |
![[ ]](/icons/layout.gif) | facingfuture.pdf | 06-Jan-2011 14:10 | 542K | |
![[ ]](/icons/layout.gif) | fourelements.pdf | 06-Jan-2011 14:10 | 1.0M | |
![[ ]](/icons/layout.gif) | frames_ref.pdf | 06-Jan-2011 14:10 | 670K | |
![[ ]](/icons/layout.gif) | fundbud1.pdf | 06-Jan-2011 14:14 | 278K | |
![[ ]](/icons/layout.gif) | good_evil_beyond.pdf | 06-Jan-2011 14:16 | 1.0M | |
![[ ]](/icons/layout.gif) | happiness-for-dummies-psychology-self-help.pdf | 06-Jan-2011 14:18 | 3.1M | |
![[ ]](/icons/layout.gif) | heart_s2.pdf | 06-Jan-2011 14:18 | 743K | |
![[ ]](/icons/layout.gif) | howtheysucceeded00mardrich.pdf | 10-Feb-2013 14:28 | 16M | |
![[ ]](/icons/layout.gif) | intuitive-awareness.pdf | 06-Jan-2011 16:20 | 511K | |
![[ ]](/icons/layout.gif) | invitation6.pdf | 06-Jan-2011 15:57 | 589K | |
![[ ]](/icons/layout.gif) | jaynes_The Study_of_the_History_of_Psychology.pdf | 06-Jan-2011 15:33 | 8.0K | |
![[ ]](/icons/layout.gif) | jaynes_consciousness-voices-mind.pdf | 06-Jan-2011 16:29 | 287K | |
![[ ]](/icons/layout.gif) | jotleeds.pdf | 06-Jan-2011 16:25 | 399K | |
![[ ]](/icons/layout.gif) | joyce - chamber music.pdf | 06-Jan-2011 16:02 | 37K | |
![[ ]](/icons/layout.gif) | joyce - ulysses.pdf | 06-Jan-2011 15:23 | 1.0M | |
![[ ]](/icons/layout.gif) | ksitigarbha.pdf | 06-Jan-2011 16:07 | 298K | |
![[ ]](/icons/layout.gif) | liaofan.pdf | 06-Jan-2011 15:38 | 1.0M | |
![[ ]](/icons/layout.gif) | libermmm.pdf | 06-Jan-2011 16:11 | 101K | |
![[ ]](/icons/layout.gif) | life universe and everything.pdf | 06-Jan-2011 16:11 | 388K | |
![[ ]](/icons/layout.gif) | lightasia.pdf | 06-Jan-2011 16:27 | 875K | |
![[ ]](/icons/layout.gif) | livngmed.pdf | 06-Jan-2011 15:36 | 272K | |
![[DIR]](/icons/folder.gif) | mIRC/ | 06-Jan-2011 16:25 | - | |
![[ ]](/icons/unknown.gif) | magick and hypnosis.doc | 06-Jan-2011 15:43 | 68K | |
![[ ]](/icons/layout.gif) | mahasati.pdf | 06-Jan-2011 15:26 | 1.1M | |
![[ ]](/icons/layout.gif) | mahasit1.pdf | 06-Jan-2011 15:28 | 181K | |
![[ ]](/icons/layout.gif) | manual_zen.pdf | 06-Jan-2011 16:29 | 944K | |
![[ ]](/icons/layout.gif) | martial arts Pressure points.pdf | 06-Jan-2011 15:46 | 1.9M | |
![[ ]](/icons/layout.gif) | matrcetahymn.pdf | 06-Jan-2011 16:17 | 535K | |
![[ ]](/icons/layout.gif) | med-guided2.pdf | 06-Jan-2011 16:25 | 431K | |
![[ ]](/icons/layout.gif) | medbudsutra.pdf | 06-Jan-2011 15:36 | 894K | |
![[ ]](/icons/layout.gif) | meditdepthpsych6.pdf | 06-Jan-2011 15:27 | 890K | |
![[ ]](/icons/layout.gif) | medwshop.pdf | 06-Jan-2011 16:10 | 151K | |
![[ ]](/icons/layout.gif) | meritsutra.pdf | 06-Jan-2011 16:07 | 297K | |
![[ ]](/icons/layout.gif) | miao_yun.pdf | 06-Jan-2011 15:43 | 784K | |
![[ ]](/icons/layout.gif) | milinda.pdf | 06-Jan-2011 15:47 | 893K | |
![[ ]](/icons/layout.gif) | mindfulness_in_plain_english.pdf | 06-Jan-2011 16:29 | 638K | |
![[ ]](/icons/layout.gif) | mindocean.pdf | 06-Jan-2011 15:38 | 449K | |
![[ ]](/icons/layout.gif) | mindread.pdf | 06-Jan-2011 16:11 | 890K | |
![[ ]](/icons/layout.gif) | mission-accomplished.pdf | 06-Jan-2011 16:10 | 1.2M | |
![[ ]](/icons/layout.gif) | monkeym.pdf | 06-Jan-2011 15:59 | 1.0M | |
![[ ]](/icons/layout.gif) | mstrhealing.pdf | 06-Jan-2011 16:08 | 1.1M | |
![[ ]](/icons/layout.gif) | myfacesofdeath.pdf | 06-Jan-2011 16:18 | 484K | |
![[ ]](/icons/layout.gif) | nat_cure.pdf | 06-Jan-2011 16:07 | 150K | |
![[ ]](/icons/layout.gif) | nibbana1.pdf | 06-Jan-2011 15:38 | 1.1M | |
![[ ]](/icons/layout.gif) | noble8path6.pdf | 06-Jan-2011 16:24 | 1.2M | |
![[ ]](/icons/layout.gif) | noinnercore.pdf | 06-Jan-2011 16:07 | 868K | |
![[ ]](/icons/layout.gif) | now_know.pdf | 06-Jan-2011 15:33 | 145K | |
![[ ]](/icons/layout.gif) | nutshell.pdf | 06-Jan-2011 16:25 | 125K | |
![[ ]](/icons/layout.gif) | one-foot-world6.pdf | 06-Jan-2011 15:47 | 1.0M | |
![[ ]](/icons/layout.gif) | only_help.pdf | 06-Jan-2011 15:32 | 1.0M | |
![[ ]](/icons/layout.gif) | powermindfulness.pdf | 06-Jan-2011 16:08 | 372K | |
![[ ]](/icons/layout.gif) | progit.en.pdf | 18-Jul-2012 10:39 | 5.4M | |
![[ ]](/icons/layout.gif) | qanda-women.pdf | 06-Jan-2011 15:58 | 795K | |
![[ ]](/icons/layout.gif) | rbddh10.pdf | 06-Jan-2011 15:36 | 675K | |
![[ ]](/icons/layout.gif) | rebirthscience.pdf | 06-Jan-2011 15:57 | 227K | |
![[ ]](/icons/layout.gif) | restaurant end of universe.pdf | 06-Jan-2011 15:35 | 392K | |
![[ ]](/icons/layout.gif) | robert anton wilson - die neue inquisition (streamload).pdf | 06-Jan-2011 16:18 | 1.2M | |
![[ ]](/icons/layout.gif) | robes-bowl6.pdf | 06-Jan-2011 15:22 | 929K | |
![[ ]](/icons/layout.gif) | samantabhadra.pdf | 06-Jan-2011 15:41 | 1.0M | |
![[ ]](/icons/layout.gif) | scrndhamma.pdf | 06-Jan-2011 15:45 | 241K | |
![[ ]](/icons/layout.gif) | seeding.pdf | 06-Jan-2011 16:11 | 71K | |
![[ ]](/icons/layout.gif) | taste-freedom.pdf | 06-Jan-2011 16:26 | 1.2M | |
![[ ]](/icons/layout.gif) | teach-train3rd.pdf | 06-Jan-2011 15:43 | 1.0M | |
![[ ]](/icons/layout.gif) | tedPAD-black.pdf | 16-Jun-2012 01:02 | 77K | |
![[ ]](/icons/layout.gif) | thanks for all the fish.pdf | 06-Jan-2011 15:57 | 342K | |
![[ ]](/icons/layout.gif) | the_book_of_ceremonial_magic.pdf | 06-Jan-2011 16:28 | 4.6M | |
![[ ]](/icons/layout.gif) | the_law_of_one_book_1.pdf | 06-Jan-2011 15:45 | 4.4M | |
![[ ]](/icons/layout.gif) | the_law_of_one_book_2.pdf | 06-Jan-2011 16:08 | 384K | |
![[ ]](/icons/layout.gif) | the_law_of_one_book_3.pdf | 06-Jan-2011 16:03 | 533K | |
![[ ]](/icons/layout.gif) | the_law_of_one_book_4.pdf | 06-Jan-2011 16:09 | 5.2M | |
![[ ]](/icons/layout.gif) | the_law_of_one_book_5.pdf | 06-Jan-2011 15:38 | 653K | |
![[TXT]](/icons/text.gif) | the cyberpunk fakebook.txt | 06-Jan-2011 16:26 | 35K | |
![[ ]](/icons/layout.gif) | volcanos.pdf | 06-Jan-2011 16:02 | 174K | |
![[DIR]](/icons/folder.gif) | vonnegut/ | 27-Aug-2012 22:24 | - | |
|